C22H25F3N4O5S — CID 174000939
(3R)-1-[(2E,4E)-8-(3-methylsulfonylazetidin-1-yl)azocin-3-yl]-3-[[6-(2,2,2-trifluoroethoxy)-2,3-dihydropyridin-3-yl]oxy]pyrrolidin-2-one (PubChem CID 174000939) has the molecular formula C22H25F3N4O5S and a molecular weight of 514.53 g/mol. Its IUPAC name is (3R)-1-[(2E,4E)-8-(3-methylsulfonylazetidin-1-yl)azocin-3-yl]-3-[[6-(2,2,2-trifluoroethoxy)-2,3-dihydropyridin-3-yl]oxy]pyrrolidin-2-one.
| Compound Name | (3R)-1-[(2E,4E)-8-(3-methylsulfonylazetidin-1-yl)azocin-3-yl]-3-[[6-(2,2,2-trifluoroethoxy)-2,3-dihydropyridin-3-yl]oxy]pyrrolidin-2-one |
|---|---|
| PubChem CID | 174000939 |
| Molecular Formula | C22H25F3N4O5S |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | (3R)-1-[(2E,4E)-8-(3-methylsulfonylazetidin-1-yl)azocin-3-yl]-3-[[6-(2,2,2-trifluoroethoxy)-2,3-dihydropyridin-3-yl]oxy]pyrrolidin-2-one |
| SMILES | CS(=O)(=O)C1CN(/C2=N/C=C(N3CC[C@@H](OC4C=CC(OCC(F)(F)F)=NC4)C3=O)\C=C/C=C2)C1 |
| InChI | InChI=1S/C22H25F3N4O5S/c1-35(31,32)17-12-28(13-17)19-5-3-2-4-15(10-26-19)29-9-8-18(21(29)30)34-16-6-7-20(27-11-16)33-14-22(23,24)25/h2-7,10,16-18H,8-9,11-14H2,1H3/b3-2?,4-2-,5-3?,15-4+,15-10+,19-5?,26-10-,26-19+/t16?,18-/m1/s1 |
| InChIKey | JFCGXIPCIUTYNF-UMNZLQGUSA-N |
| XLogP | 1.61 |
| TPSA | 100.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |