C18H32N2O — CID 174001074
(4Z,6E,8Z)-6-(2-aminoethoxy)-N-methyl-N-[(Z)-2-methylbut-1-enyl]deca-4,6,8-trien-5-amine (PubChem CID 174001074) has the molecular formula C18H32N2O and a molecular weight of 292.47 g/mol. Its IUPAC name is (4Z,6E,8Z)-6-(2-aminoethoxy)-N-methyl-N-[(Z)-2-methylbut-1-enyl]deca-4,6,8-trien-5-amine.
| Compound Name | (4Z,6E,8Z)-6-(2-aminoethoxy)-N-methyl-N-[(Z)-2-methylbut-1-enyl]deca-4,6,8-trien-5-amine |
|---|---|
| PubChem CID | 174001074 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | (4Z,6E,8Z)-6-(2-aminoethoxy)-N-methyl-N-[(Z)-2-methylbut-1-enyl]deca-4,6,8-trien-5-amine |
| SMILES | C/C=C\C=C(OCCN)/C(=C/CCC)N(C)/C=C(/C)CC |
| InChI | InChI=1S/C18H32N2O/c1-6-9-11-17(20(5)15-16(4)8-3)18(12-10-7-2)21-14-13-19/h7,10-12,15H,6,8-9,13-14,19H2,1-5H3/b10-7-,16-15-,17-11-,18-12+ |
| InChIKey | SXGGVNZGOSBMNS-JWCNFERYSA-N |
| XLogP | 4.35 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|