C30H37Cl2FN6O4 — CID 174001119
CID 174001119 (PubChem CID 174001119) has the molecular formula C30H37Cl2FN6O4 and a molecular weight of 635.57 g/mol.
| Compound Name | CID 174001119 |
|---|---|
| PubChem CID | 174001119 |
| Molecular Formula | C30H37Cl2FN6O4 |
| Molecular Weight | 635.57 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | — |
| SMILES | C=C(Cl)N=C/C=C(\F)[C@H]1[C@H](C(=O)N[C@@H]2CC[C@@H](C(=O)NC)OC2)NC2(CCC(C)(C)CC2)[C@@]12C(=O)Nc1nc(Cl)ccc12 |
| InChI | InChI=1S/C30H37Cl2FN6O4/c1-16(31)35-14-9-19(33)22-23(26(41)36-17-5-7-20(43-15-17)25(40)34-4)39-29(12-10-28(2,3)11-13-29)30(22)18-6-8-21(32)37-24(18)38-27(30)42/h6,8-9,14,17,20,22-23,39H,1,5,7,10-13,15H2,2-4H3,(H,34,40)(H,36,41)(H,37,38,42)/b19-9-,35-14?/t17-,20+,22+,23-,30-/m1/s1 |
| InChIKey | RRMMDZNINPVJJJ-BHQVEFCDSA-N |
| XLogP | 3.90 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|