C21H31ClN6O — CID 174001169
3-chloro-N-(3-iminopropyl)-4-[4-[(Z)-3-(methylaminomethylimino)-1-(methylideneamino)but-1-enyl]-1,4-oxazepan-3-yl]aniline (PubChem CID 174001169) has the molecular formula C21H31ClN6O and a molecular weight of 418.97 g/mol. Its IUPAC name is 3-chloro-N-(3-iminopropyl)-4-[4-[(Z)-3-(methylaminomethylimino)-1-(methylideneamino)but-1-enyl]-1,4-oxazepan-3-yl]aniline.
| Compound Name | 3-chloro-N-(3-iminopropyl)-4-[4-[(Z)-3-(methylaminomethylimino)-1-(methylideneamino)but-1-enyl]-1,4-oxazepan-3-yl]aniline |
|---|---|
| PubChem CID | 174001169 |
| Molecular Formula | C21H31ClN6O |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 3-chloro-N-(3-iminopropyl)-4-[4-[(Z)-3-(methylaminomethylimino)-1-(methylideneamino)but-1-enyl]-1,4-oxazepan-3-yl]aniline |
| SMILES | [H]/N=C/CCNc1ccc(C2COCCCN2/C(=C/C(C)=NCNC)N=C)c(Cl)c1 |
| InChI | InChI=1S/C21H31ClN6O/c1-16(27-15-24-2)12-21(25-3)28-10-5-11-29-14-20(28)18-7-6-17(13-19(18)22)26-9-4-8-23/h6-8,12-13,20,23-24,26H,3-5,9-11,14-15H2,1-2H3/b21-12+,23-8+,27-16? |
| InChIKey | TVQAYKHSMMFFDQ-PSSKWCIZSA-N |
| XLogP | 3.73 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|