C48H54N6O5Si — CID 174001203
7-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(trityloxymethyl)oxolan-2-yl]-N-[(2,4-dimethoxyphenyl)methyl]-5-pyrazol-1-ylpyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 174001203) has the molecular formula C48H54N6O5Si and a molecular weight of 823.08 g/mol. Its IUPAC name is 7-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(trityloxymethyl)oxolan-2-yl]-N-[(2,4-dimethoxyphenyl)methyl]-5-pyrazol-1-ylpyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(trityloxymethyl)oxolan-2-yl]-N-[(2,4-dimethoxyphenyl)methyl]-5-pyrazol-1-ylpyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 174001203 |
| Molecular Formula | C48H54N6O5Si |
| Molecular Weight | 823.08 g/mol |
| Exact Mass | 822.39 |
| IUPAC Name | 7-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-(trityloxymethyl)oxolan-2-yl]-N-[(2,4-dimethoxyphenyl)methyl]-5-pyrazol-1-ylpyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | COc1ccc(CNc2ncnc3c2c(-n2cccn2)cn3[C@H]2CC(O[Si](C)(C)C(C)(C)C)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)O2)c(OC)c1 |
| InChI | InChI=1S/C48H54N6O5Si/c1-47(2,3)60(6,7)59-41-29-43(58-42(41)32-57-48(35-18-11-8-12-19-35,36-20-13-9-14-21-36)37-22-15-10-16-23-37)53-31-39(54-27-17-26-52-54)44-45(50-33-51-46(44)53)49-30-34-24-25-38(55-4)28-40(34)56-5/h8-28,31,33,41-43H,29-30,32H2,1-7H3,(H,49,50,51)/t41?,42-,43-/m1/s1 |
| InChIKey | XGSLYIGZUUCHQD-LTSQTOAOSA-N |
| XLogP | 9.93 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.08 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|