About CID 174001207
CID 174001207 (PubChem CID 174001207) has the molecular formula C15H13B2N7O6
and a molecular weight of 408.94 g/mol.
Molecular Properties
| Compound Name | CID 174001207 |
| PubChem CID | 174001207 |
| Molecular Formula | C15H13B2N7O6 |
| Molecular Weight | 408.94 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)C(O)(n1nc(-c2ccc3oc(N)nc3c2)c2c(N)ncnc21)C([B])(O)O |
| InChI | InChI=1S/C15H13B2N7O6/c16-14(26,27)13(25,15(17,28)29)24-11-8(10(18)20-4-21-11)9(23-24)5-1-2-7-6(3-5)22-12(19)30-7/h1-4,25-29H,(H2,19,22)(H2,18,20,21) |
| InChIKey | QSNMDMVFLDOMSZ-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 222.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 408.94 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 174001207 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174001207?
The IUPAC name of CID 174001207 (CID 174001207) is not available.
What is the SMILES notation for CID 174001207?
The canonical SMILES for CID 174001207 is [B]C(O)(O)C(O)(n1nc(-c2ccc3oc(N)nc3c2)c2c(N)ncnc21)C([B])(O)O.
What is the InChIKey of CID 174001207?
The InChIKey is QSNMDMVFLDOMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13B2N7O6/c16-14(26,27)13(25,15(17,28)29)24-11-8(10(18)20-4-21-11)9(23-24)5-1-2-7-6(3-5)22-12(19)30-7/h1-4,25-29H,(H2,19,22)(H2,18,20,21).
What are the key properties of CID 174001207?
CID 174001207 has a molecular weight of 408.94 g/mol, XLogP of -2.94, 4 rotatable bonds, 7 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174001207 is sourced from PubChem (CID 174001207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).