C18H28N4O — CID 174001311
(2R,7Z)-9-methyl-5-[(Z)-1-morpholin-4-ylprop-1-enyl]iminodeca-7,9-dien-3-yne-2,6-diamine (PubChem CID 174001311) has the molecular formula C18H28N4O and a molecular weight of 316.45 g/mol. Its IUPAC name is (2R,7Z)-9-methyl-5-[(Z)-1-morpholin-4-ylprop-1-enyl]iminodeca-7,9-dien-3-yne-2,6-diamine.
| Compound Name | (2R,7Z)-9-methyl-5-[(Z)-1-morpholin-4-ylprop-1-enyl]iminodeca-7,9-dien-3-yne-2,6-diamine |
|---|---|
| PubChem CID | 174001311 |
| Molecular Formula | C18H28N4O |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | (2R,7Z)-9-methyl-5-[(Z)-1-morpholin-4-ylprop-1-enyl]iminodeca-7,9-dien-3-yne-2,6-diamine |
| SMILES | C=C(C)/C=C\C(N)C(C#C[C@@H](C)N)=N/C(=C\C)N1CCOCC1 |
| InChI | InChI=1S/C18H28N4O/c1-5-18(22-10-12-23-13-11-22)21-17(9-7-15(4)19)16(20)8-6-14(2)3/h5-6,8,15-16H,2,10-13,19-20H2,1,3-4H3/b8-6-,18-5+,21-17?/t15-,16?/m1/s1 |
| InChIKey | SJWQPMBWLGETQI-WYOUBYQISA-N |
| XLogP | 1.43 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|