About [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine
[1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine (PubChem CID 174001512) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine.
Molecular Properties
| Compound Name | [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine |
| PubChem CID | 174001512 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine |
| SMILES | CC1=CCC[C@H](C)C1C(C)=NCN |
| InChI | InChI=1S/C11H20N2/c1-8-5-4-6-9(2)11(8)10(3)13-7-12/h5,9,11H,4,6-7,12H2,1-3H3/t9-,11?/m0/s1 |
| InChIKey | TWHPKGIQIYQTQG-FTNKSUMCSA-N |
| XLogP | 2.36 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine?
The IUPAC name of [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine (CID 174001512) is [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine.
What is the SMILES notation for [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine?
The canonical SMILES for [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine is CC1=CCC[C@H](C)C1C(C)=NCN.
What is the InChIKey of [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine?
The InChIKey is TWHPKGIQIYQTQG-FTNKSUMCSA-N. The full InChI is InChI=1S/C11H20N2/c1-8-5-4-6-9(2)11(8)10(3)13-7-12/h5,9,11H,4,6-7,12H2,1-3H3/t9-,11?/m0/s1.
What are the key properties of [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine?
[1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine has a molecular weight of 180.29 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(6S)-2,6-dimethylcyclohex-2-en-1-yl]ethylideneamino]methanamine is sourced from PubChem (CID 174001512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).