C13H22N2 — CID 174001735
3-imino-2-methyl-1-[(1R,6S)-1,2,6-trimethylcyclohex-3-en-1-yl]prop-1-en-1-amine (PubChem CID 174001735) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 3-imino-2-methyl-1-[(1R,6S)-1,2,6-trimethylcyclohex-3-en-1-yl]prop-1-en-1-amine.
| Compound Name | 3-imino-2-methyl-1-[(1R,6S)-1,2,6-trimethylcyclohex-3-en-1-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 174001735 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 3-imino-2-methyl-1-[(1R,6S)-1,2,6-trimethylcyclohex-3-en-1-yl]prop-1-en-1-amine |
| SMILES | [H]/N=C/C(C)=C(N)[C@@]1(C)C(C)C=CC[C@@H]1C |
| InChI | InChI=1S/C13H22N2/c1-9(8-14)12(15)13(4)10(2)6-5-7-11(13)3/h5-6,8,10-11,14H,7,15H2,1-4H3/b12-9?,14-8+/t10?,11-,13-/m0/s1 |
| InChIKey | JQHLRLHDBCKAKV-FIDRVLMCSA-N |
| XLogP | 3.11 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|