About 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine
1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine (PubChem CID 174002188) has the molecular formula C12H25FN2O
and a molecular weight of 232.34 g/mol. Its IUPAC name is 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine.
Molecular Properties
| Compound Name | 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine |
| PubChem CID | 174002188 |
| Molecular Formula | C12H25FN2O |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine |
| SMILES | CC/C=C(/F)CC(C)[C@@H](C)NNCCOC |
| InChI | InChI=1S/C12H25FN2O/c1-5-6-12(13)9-10(2)11(3)15-14-7-8-16-4/h6,10-11,14-15H,5,7-9H2,1-4H3/b12-6+/t10?,11-/m1/s1 |
| InChIKey | HKFPNEVIBYBRSE-BRWLHLSKSA-N |
| XLogP | 2.41 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine?
The IUPAC name of 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine (CID 174002188) is 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine.
What is the SMILES notation for 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine?
The canonical SMILES for 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine is CC/C=C(/F)CC(C)[C@@H](C)NNCCOC.
What is the InChIKey of 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine?
The InChIKey is HKFPNEVIBYBRSE-BRWLHLSKSA-N. The full InChI is InChI=1S/C12H25FN2O/c1-5-6-12(13)9-10(2)11(3)15-14-7-8-16-4/h6,10-11,14-15H,5,7-9H2,1-4H3/b12-6+/t10?,11-/m1/s1.
What are the key properties of 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine?
1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine has a molecular weight of 232.34 g/mol, XLogP of 2.41, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E,2R)-5-fluoro-3-methyloct-5-en-2-yl]-2-(2-methoxyethyl)hydrazine is sourced from PubChem (CID 174002188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).