C9H17NO — CID 174002272
(5S)-3,5-dimethyl-6-nitrosohept-1-ene (PubChem CID 174002272) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (5S)-3,5-dimethyl-6-nitrosohept-1-ene.
| Compound Name | (5S)-3,5-dimethyl-6-nitrosohept-1-ene |
|---|---|
| PubChem CID | 174002272 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (5S)-3,5-dimethyl-6-nitrosohept-1-ene |
| SMILES | C=CC(C)C[C@H](C)C(C)N=O |
| InChI | InChI=1S/C9H17NO/c1-5-7(2)6-8(3)9(4)10-11/h5,7-9H,1,6H2,2-4H3/t7?,8-,9?/m0/s1 |
| InChIKey | QHGHLLHCRVTWLX-MGURRDGZSA-N |
| XLogP | 2.99 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|