C16H21BClN3O3 — CID 174002364
[(1E,3Z)-1-amino-6-(5-chloro-1-methylpyrrolo[2,3-c]pyridin-2-yl)-1-ethoxyhexa-1,3-dien-2-yl]boronic acid (PubChem CID 174002364) has the molecular formula C16H21BClN3O3 and a molecular weight of 349.63 g/mol. Its IUPAC name is [(1E,3Z)-1-amino-6-(5-chloro-1-methylpyrrolo[2,3-c]pyridin-2-yl)-1-ethoxyhexa-1,3-dien-2-yl]boronic acid.
| Compound Name | [(1E,3Z)-1-amino-6-(5-chloro-1-methylpyrrolo[2,3-c]pyridin-2-yl)-1-ethoxyhexa-1,3-dien-2-yl]boronic acid |
|---|---|
| PubChem CID | 174002364 |
| Molecular Formula | C16H21BClN3O3 |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [(1E,3Z)-1-amino-6-(5-chloro-1-methylpyrrolo[2,3-c]pyridin-2-yl)-1-ethoxyhexa-1,3-dien-2-yl]boronic acid |
| SMILES | CCO/C(N)=C(/C=C\CCc1cc2cc(Cl)ncc2n1C)B(O)O |
| InChI | InChI=1S/C16H21BClN3O3/c1-3-24-16(19)13(17(22)23)7-5-4-6-12-8-11-9-15(18)20-10-14(11)21(12)2/h5,7-10,22-23H,3-4,6,19H2,1-2H3/b7-5-,16-13- |
| InChIKey | OPAPFNKKVGJYAY-BHPCLCIMSA-N |
| XLogP | 1.93 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|