C20H30BNO2 — CID 174002507
(2R)-2-cyclopropyl-1,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-quinoline (PubChem CID 174002507) has the molecular formula C20H30BNO2 and a molecular weight of 327.28 g/mol. Its IUPAC name is (2R)-2-cyclopropyl-1,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-quinoline.
| Compound Name | (2R)-2-cyclopropyl-1,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 174002507 |
| Molecular Formula | C20H30BNO2 |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | (2R)-2-cyclopropyl-1,3-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-quinoline |
| SMILES | CC1Cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2N(C)[C@H]1C1CC1 |
| InChI | InChI=1S/C20H30BNO2/c1-13-11-15-12-16(21-23-19(2,3)20(4,5)24-21)9-10-17(15)22(6)18(13)14-7-8-14/h9-10,12-14,18H,7-8,11H2,1-6H3/t13?,18-/m1/s1 |
| InChIKey | KWAOXZDRBSUYOC-PQJIZZRHSA-N |
| XLogP | 3.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|