About CID 174002657
CID 174002657 (PubChem CID 174002657) has the molecular formula C14H12B2
and a molecular weight of 201.87 g/mol.
Molecular Properties
| Compound Name | CID 174002657 |
| PubChem CID | 174002657 |
| Molecular Formula | C14H12B2 |
| Molecular Weight | 201.87 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2ccc([B])c(C)c2)cc1C |
| InChI | InChI=1S/C14H12B2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,1-2H3 |
| InChIKey | BCVVMUXKFGDIEJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.87 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174002657 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174002657?
The IUPAC name of CID 174002657 (CID 174002657) is not available.
What is the SMILES notation for CID 174002657?
The canonical SMILES for CID 174002657 is [B]c1ccc(-c2ccc([B])c(C)c2)cc1C.
What is the InChIKey of CID 174002657?
The InChIKey is BCVVMUXKFGDIEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12B2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,1-2H3.
What are the key properties of CID 174002657?
CID 174002657 has a molecular weight of 201.87 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174002657 is sourced from PubChem (CID 174002657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).