C18H22F2N2O — CID 174003396
N-[(2E,4Z,6Z)-7-[(5,7-difluorocyclohepta-1,3,6-trien-1-yl)-methylamino]-4-methylocta-2,4,6-trienyl]formamide (PubChem CID 174003396) has the molecular formula C18H22F2N2O and a molecular weight of 320.38 g/mol. Its IUPAC name is N-[(2E,4Z,6Z)-7-[(5,7-difluorocyclohepta-1,3,6-trien-1-yl)-methylamino]-4-methylocta-2,4,6-trienyl]formamide.
| Compound Name | N-[(2E,4Z,6Z)-7-[(5,7-difluorocyclohepta-1,3,6-trien-1-yl)-methylamino]-4-methylocta-2,4,6-trienyl]formamide |
|---|---|
| PubChem CID | 174003396 |
| Molecular Formula | C18H22F2N2O |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[(2E,4Z,6Z)-7-[(5,7-difluorocyclohepta-1,3,6-trien-1-yl)-methylamino]-4-methylocta-2,4,6-trienyl]formamide |
| SMILES | CC(=C/C=C(/C)N(C)C1=CC=CC(F)C=C1F)/C=C/CNC=O |
| InChI | InChI=1S/C18H22F2N2O/c1-14(6-5-11-21-13-23)9-10-15(2)22(3)18-8-4-7-16(19)12-17(18)20/h4-10,12-13,16H,11H2,1-3H3,(H,21,23)/b6-5+,14-9-,15-10- |
| InChIKey | CMNQCRATGFBFGW-SJRVMEQZSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|