C42H54FN — CID 174004107
4-tert-butyl-2-[4-[2-[4-[(3R,4S,5S,6R)-6-fluoro-2,3,4,5-tetramethylheptyl]-2,3,5,6-tetramethylphenyl]phenyl]phenyl]pyridine (PubChem CID 174004107) has the molecular formula C42H54FN and a molecular weight of 591.90 g/mol. Its IUPAC name is 4-tert-butyl-2-[4-[2-[4-[(3R,4S,5S,6R)-6-fluoro-2,3,4,5-tetramethylheptyl]-2,3,5,6-tetramethylphenyl]phenyl]phenyl]pyridine.
| Compound Name | 4-tert-butyl-2-[4-[2-[4-[(3R,4S,5S,6R)-6-fluoro-2,3,4,5-tetramethylheptyl]-2,3,5,6-tetramethylphenyl]phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 174004107 |
| Molecular Formula | C42H54FN |
| Molecular Weight | 591.90 g/mol |
| Exact Mass | 591.42 |
| IUPAC Name | 4-tert-butyl-2-[4-[2-[4-[(3R,4S,5S,6R)-6-fluoro-2,3,4,5-tetramethylheptyl]-2,3,5,6-tetramethylphenyl]phenyl]phenyl]pyridine |
| SMILES | Cc1c(C)c(-c2ccccc2-c2ccc(-c3cc(C(C)(C)C)ccn3)cc2)c(C)c(C)c1CC(C)[C@@H](C)[C@H](C)[C@H](C)[C@@H](C)F |
| InChI | InChI=1S/C42H54FN/c1-25(26(2)27(3)28(4)33(9)43)23-39-29(5)31(7)41(32(8)30(39)6)38-16-14-13-15-37(38)34-17-19-35(20-18-34)40-24-36(21-22-44-40)42(10,11)12/h13-22,24-28,33H,23H2,1-12H3/t25?,26-,27+,28+,33-/m1/s1 |
| InChIKey | ILSYGLOXJRNUKN-ZVMZFRBVSA-N |
| XLogP | 12.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.90 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |