C21H21F3N2O3 — CID 174004110
N-[(3R,4S)-3-methyl-4-[(1S,2S,5R,6S)-5-methyl-2-bicyclo[4.1.0]hept-3-enyl]-2,5-dioxopyrrolidin-1-yl]-4-(trifluoromethyl)benzamide (PubChem CID 174004110) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is N-[(3R,4S)-3-methyl-4-[(1S,2S,5R,6S)-5-methyl-2-bicyclo[4.1.0]hept-3-enyl]-2,5-dioxopyrrolidin-1-yl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(3R,4S)-3-methyl-4-[(1S,2S,5R,6S)-5-methyl-2-bicyclo[4.1.0]hept-3-enyl]-2,5-dioxopyrrolidin-1-yl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174004110 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-[(3R,4S)-3-methyl-4-[(1S,2S,5R,6S)-5-methyl-2-bicyclo[4.1.0]hept-3-enyl]-2,5-dioxopyrrolidin-1-yl]-4-(trifluoromethyl)benzamide |
| SMILES | C[C@@H]1C=C[C@H]([C@@H]2C(=O)N(NC(=O)c3ccc(C(F)(F)F)cc3)C(=O)[C@@H]2C)[C@H]2C[C@H]21 |
| InChI | InChI=1S/C21H21F3N2O3/c1-10-3-8-14(16-9-15(10)16)17-11(2)19(28)26(20(17)29)25-18(27)12-4-6-13(7-5-12)21(22,23)24/h3-8,10-11,14-17H,9H2,1-2H3,(H,25,27)/t10-,11-,14+,15+,16-,17-/m1/s1 |
| InChIKey | ZKTFWDMUDMRVSO-IPMVXICZSA-N |
| XLogP | 3.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|