C28H43N3O9S — CID 174004637
N-[3-[2-[2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethoxy]ethoxy]propyl]-5-[(1R)-3-methylsulfanyl-2,5-dioxocyclopentyl]pentanamide (PubChem CID 174004637) has the molecular formula C28H43N3O9S and a molecular weight of 597.73 g/mol. Its IUPAC name is N-[3-[2-[2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethoxy]ethoxy]propyl]-5-[(1R)-3-methylsulfanyl-2,5-dioxocyclopentyl]pentanamide.
| Compound Name | N-[3-[2-[2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethoxy]ethoxy]propyl]-5-[(1R)-3-methylsulfanyl-2,5-dioxocyclopentyl]pentanamide |
|---|---|
| PubChem CID | 174004637 |
| Molecular Formula | C28H43N3O9S |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | N-[3-[2-[2-[3-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propoxy]ethoxy]ethoxy]propyl]-5-[(1R)-3-methylsulfanyl-2,5-dioxocyclopentyl]pentanamide |
| SMILES | CSC1CC(=O)[C@@H](CCCCC(=O)NCCCOCCOCCOCCCNC(=O)CCN2C(=O)C=CC2=O)C1=O |
| InChI | InChI=1S/C28H43N3O9S/c1-41-23-20-22(32)21(28(23)37)6-2-3-7-24(33)29-11-4-14-38-16-18-40-19-17-39-15-5-12-30-25(34)10-13-31-26(35)8-9-27(31)36/h8-9,21,23H,2-7,10-20H2,1H3,(H,29,33)(H,30,34)/t21-,23?/m1/s1 |
| InChIKey | ZDVALSYUXAPEEE-FKHAVUOCSA-N |
| XLogP | 0.81 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|