C16H24F3N5O2 — CID 174004818
[(Z,5S)-5-(ethylcarbamoylamino)-8,8,8-trifluorooct-2-enyl] 1-methylimidazole-2-carboximidate (PubChem CID 174004818) has the molecular formula C16H24F3N5O2 and a molecular weight of 375.40 g/mol. Its IUPAC name is [(Z,5S)-5-(ethylcarbamoylamino)-8,8,8-trifluorooct-2-enyl] 1-methylimidazole-2-carboximidate.
| Compound Name | [(Z,5S)-5-(ethylcarbamoylamino)-8,8,8-trifluorooct-2-enyl] 1-methylimidazole-2-carboximidate |
|---|---|
| PubChem CID | 174004818 |
| Molecular Formula | C16H24F3N5O2 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | [(Z,5S)-5-(ethylcarbamoylamino)-8,8,8-trifluorooct-2-enyl] 1-methylimidazole-2-carboximidate |
| SMILES | [H]/N=C(\OC/C=C\C[C@H](CCC(F)(F)F)NC(=O)NCC)c1nccn1C |
| InChI | InChI=1S/C16H24F3N5O2/c1-3-21-15(25)23-12(7-8-16(17,18)19)6-4-5-11-26-13(20)14-22-9-10-24(14)2/h4-5,9-10,12,20H,3,6-8,11H2,1-2H3,(H2,21,23,25)/b5-4-,20-13-/t12-/m1/s1 |
| InChIKey | TVSAEUFDHWZREL-QKBGRYLOSA-N |
| XLogP | 2.74 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|