C27H42N8O — CID 174004840
1-[7-[4-[[(4S)-2-hydrazinylidene-1-imino-6-methylheptan-4-yl]amino]-7,7-dimethyl-6,8-dihydro-5H-quinazolin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one (PubChem CID 174004840) has the molecular formula C27H42N8O and a molecular weight of 494.69 g/mol. Its IUPAC name is 1-[7-[4-[[(4S)-2-hydrazinylidene-1-imino-6-methylheptan-4-yl]amino]-7,7-dimethyl-6,8-dihydro-5H-quinazolin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[7-[4-[[(4S)-2-hydrazinylidene-1-imino-6-methylheptan-4-yl]amino]-7,7-dimethyl-6,8-dihydro-5H-quinazolin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 174004840 |
| Molecular Formula | C27H42N8O |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | 1-[7-[4-[[(4S)-2-hydrazinylidene-1-imino-6-methylheptan-4-yl]amino]-7,7-dimethyl-6,8-dihydro-5H-quinazolin-2-yl]-2,7-diazaspiro[3.4]octan-2-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/C(C[C@H](CC(C)C)Nc1nc(N2CCC3(CN(C(=O)C=C)C3)C2)nc2c1CCC(C)(C)C2)=NN |
| InChI | InChI=1S/C27H42N8O/c1-6-23(36)35-16-27(17-35)9-10-34(15-27)25-31-22-13-26(4,5)8-7-21(22)24(32-25)30-19(11-18(2)3)12-20(14-28)33-29/h6,14,18-19,28H,1,7-13,15-17,29H2,2-5H3,(H,30,31,32)/b28-14+,33-20?/t19-/m0/s1 |
| InChIKey | AHDYQBYNOCLVOP-IAIPQOLQSA-N |
| XLogP | 3.40 |
| TPSA | 123.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|