C57H43BFN5O2 — CID 174004940
12-[4-[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-5-(4-phenylphenyl)indolo[3,2-c]carbazole (PubChem CID 174004940) has the molecular formula C57H43BFN5O2 and a molecular weight of 859.81 g/mol. Its IUPAC name is 12-[4-[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-5-(4-phenylphenyl)indolo[3,2-c]carbazole.
| Compound Name | 12-[4-[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-5-(4-phenylphenyl)indolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 174004940 |
| Molecular Formula | C57H43BFN5O2 |
| Molecular Weight | 859.81 g/mol |
| Exact Mass | 859.35 |
| IUPAC Name | 12-[4-[3-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-5-(4-phenylphenyl)indolo[3,2-c]carbazole |
| SMILES | CC1(C)OB(c2c(F)cccc2-c2nc(-c3ccc(-c4ccccc4)cc3)nc(-n3c4ccccc4c4ccc5c(c6ccccc6n5-c5ccc(-c6ccccc6)cc5)c43)n2)OC1(C)C |
| InChI | InChI=1S/C57H43BFN5O2/c1-56(2)57(3,4)66-58(65-56)51-45(22-15-23-46(51)59)54-60-53(40-28-26-38(27-29-40)36-16-7-5-8-17-36)61-55(62-54)64-47-24-13-11-20-42(47)43-34-35-49-50(52(43)64)44-21-12-14-25-48(44)63(49)41-32-30-39(31-33-41)37-18-9-6-10-19-37/h5-35H,1-4H3 |
| InChIKey | SRSJQGOXRKDSDR-UHFFFAOYSA-N |
| XLogP | 13.17 |
| TPSA | 66.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.81 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|