About CID 174005440
CID 174005440 (PubChem CID 174005440) has the molecular formula C90H68F4N2O12S8
and a molecular weight of 1702.06 g/mol.
Molecular Properties
| Compound Name | CID 174005440 |
| PubChem CID | 174005440 |
| Molecular Formula | C90H68F4N2O12S8 |
| Molecular Weight | 1702.06 g/mol |
| Exact Mass | 1700.25 |
| IUPAC Name | — |
| SMILES | O=C1C(=Cc2cc3c(s2)-c2sc4c5c(sc4c2C2(CCCCC2)O3)-c2sc(C=C3C(=O)c4cc(F)c(F)cc4C3=O)cc2OC52CCC(C3CCC4(CC3)Oc3cc(N=C5C(=O)C6CCCCC6C5=O)sc3-c3sc5c6c(sc5c34)-c3sc(N=C4C(=O)C5CCCCC5C4=O)cc3OC63CCCCC3)CC2)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C90H68F4N2O12S8/c91-51-31-45-46(32-52(51)92)68(98)49(67(45)97)27-39-29-55-75(109-39)79-61(87(105-55)19-7-1-8-20-87)83-85(113-79)63-80(114-83)76-56(30-40(110-76)28-50-69(99)47-33-53(93)54(94)34-48(47)70(50)100)106-89(63)23-15-37(16-24-89)38-17-25-90(26-18-38)64-82(78-58(108-90)36-60(112-78)96-66-73(103)43-13-5-6-14-44(43)74(66)104)116-84-62-81(115-86(64)84)77-57(107-88(62)21-9-2-10-22-88)35-59(111-77)95-65-71(101)41-11-3-4-12-42(41)72(65)102/h27-38,41-44H,1-26H2 |
| InChIKey | ZZARUMWZNUOHCB-UHFFFAOYSA-N |
| XLogP | 24.06 |
| TPSA | 198.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 116 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1702.06 |
| LogP ≤ 5 | 24.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze CID 174005440 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174005440?
The IUPAC name of CID 174005440 (CID 174005440) is not available.
What is the SMILES notation for CID 174005440?
The canonical SMILES for CID 174005440 is O=C1C(=Cc2cc3c(s2)-c2sc4c5c(sc4c2C2(CCCCC2)O3)-c2sc(C=C3C(=O)c4cc(F)c(F)cc4C3=O)cc2OC52CCC(C3CCC4(CC3)Oc3cc(N=C5C(=O)C6CCCCC6C5=O)sc3-c3sc5c6c(sc5c34)-c3sc(N=C4C(=O)C5CCCCC5C4=O)cc3OC63CCCCC3)CC2)C(=O)c2cc(F)c(F)cc21.
What is the InChIKey of CID 174005440?
The InChIKey is ZZARUMWZNUOHCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C90H68F4N2O12S8/c91-51-31-45-46(32-52(51)92)68(98)49(67(45)97)27-39-29-55-75(109-39)79-61(87(105-55)19-7-1-8-20-87)83-85(113-79)63-80(114-83)76-56(30-40(110-76)28-50-69(99)47-33-53(93)54(94)34-48(47)70(50)100)106-89(63)23-15-37(16-24-89)38-17-25-90(26-18-38)64-82(78-58(108-90)36-60(112-78)96-66-73(103)43-13-5-6-14-44(43)74(66)104)116-84-62-81(115-86(64)84)77-57(107-88(62)21-9-2-10-22-88)35-59(111-77)95-65-71(101)41-11-3-4-12-42(41)72(65)102/h27-38,41-44H,1-26H2.
What are the key properties of CID 174005440?
CID 174005440 has a molecular weight of 1702.06 g/mol, XLogP of 24.06, 5 rotatable bonds, 0 hydrogen bond donors, and 22 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174005440 is sourced from PubChem (CID 174005440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).