C23H27F3N8O2 — CID 174005594
(3S)-7-[[3-amino-2-[[6-(trifluoromethyl)-3-pyridinyl]methyliminomethyl]prop-2-enyl]amino]-4-(2-hydroxyethyl)-3-methyl-1,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one (PubChem CID 174005594) has the molecular formula C23H27F3N8O2 and a molecular weight of 504.52 g/mol. Its IUPAC name is (3S)-7-[[3-amino-2-[[6-(trifluoromethyl)-3-pyridinyl]methyliminomethyl]prop-2-enyl]amino]-4-(2-hydroxyethyl)-3-methyl-1,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one.
| Compound Name | (3S)-7-[[3-amino-2-[[6-(trifluoromethyl)-3-pyridinyl]methyliminomethyl]prop-2-enyl]amino]-4-(2-hydroxyethyl)-3-methyl-1,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
|---|---|
| PubChem CID | 174005594 |
| Molecular Formula | C23H27F3N8O2 |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | (3S)-7-[[3-amino-2-[[6-(trifluoromethyl)-3-pyridinyl]methyliminomethyl]prop-2-enyl]amino]-4-(2-hydroxyethyl)-3-methyl-1,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
| SMILES | C[C@H]1C(=O)N2CCCc3nc(NCC(=CN)/C=N/Cc4ccc(C(F)(F)F)nc4)nc(c32)N1CCO |
| InChI | InChI=1S/C23H27F3N8O2/c1-14-21(36)34-6-2-3-17-19(34)20(33(14)7-8-35)32-22(31-17)30-13-16(9-27)11-28-10-15-4-5-18(29-12-15)23(24,25)26/h4-5,9,11-12,14,35H,2-3,6-8,10,13,27H2,1H3,(H,30,31,32)/b16-9?,28-11+/t14-/m0/s1 |
| InChIKey | BTFLJZCNYKBGEW-ZPSINZRMSA-N |
| XLogP | 1.90 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|