C40H21B5N2 — CID 174005748
CID 174005748 (PubChem CID 174005748) has the molecular formula C40H21B5N2 and a molecular weight of 583.68 g/mol.
| Compound Name | CID 174005748 |
|---|---|
| PubChem CID | 174005748 |
| Molecular Formula | C40H21B5N2 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2c3ccccc3c(-c3ccc4cc(-c5cc(-c6cccnc6)ccn5)ccc4c3)c3ccccc23)c([B])c1[B] |
| InChI | InChI=1S/C40H21B5N2/c41-36-35(37(42)39(44)40(45)38(36)43)34-30-9-3-1-7-28(30)33(29-8-2-4-10-31(29)34)26-14-12-22-18-25(13-11-23(22)19-26)32-20-24(15-17-47-32)27-6-5-16-46-21-27/h1-21H |
| InChIKey | CTWHIUPMTOPQQX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|