C11H19NO7 — CID 174005749
(Z,5S)-5-acetamido-2-[(2R)-2,3-dihydroxypropoxy]-4-hydroxyhex-2-enoic acid (PubChem CID 174005749) has the molecular formula C11H19NO7 and a molecular weight of 277.27 g/mol. Its IUPAC name is (Z,5S)-5-acetamido-2-[(2R)-2,3-dihydroxypropoxy]-4-hydroxyhex-2-enoic acid.
| Compound Name | (Z,5S)-5-acetamido-2-[(2R)-2,3-dihydroxypropoxy]-4-hydroxyhex-2-enoic acid |
|---|---|
| PubChem CID | 174005749 |
| Molecular Formula | C11H19NO7 |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (Z,5S)-5-acetamido-2-[(2R)-2,3-dihydroxypropoxy]-4-hydroxyhex-2-enoic acid |
| SMILES | CC(=O)N[C@@H](C)C(O)/C=C(\OC[C@H](O)CO)C(=O)O |
| InChI | InChI=1S/C11H19NO7/c1-6(12-7(2)14)9(16)3-10(11(17)18)19-5-8(15)4-13/h3,6,8-9,13,15-16H,4-5H2,1-2H3,(H,12,14)(H,17,18)/b10-3-/t6-,8+,9?/m0/s1 |
| InChIKey | JFLMTTPLYWKMIR-MAXIORFDSA-N |
| XLogP | -1.79 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|