C21H27FN2 — CID 174005822
(3Z,4E,5Z)-4-ethylidene-N-[[(5E)-8-fluoro-2-methylcycloocta-1,5,7-trien-1-yl]methyl]-3-[(methylideneamino)methylidene]hepta-1,5-dien-2-amine (PubChem CID 174005822) has the molecular formula C21H27FN2 and a molecular weight of 326.46 g/mol. Its IUPAC name is (3Z,4E,5Z)-4-ethylidene-N-[[(5E)-8-fluoro-2-methylcycloocta-1,5,7-trien-1-yl]methyl]-3-[(methylideneamino)methylidene]hepta-1,5-dien-2-amine.
| Compound Name | (3Z,4E,5Z)-4-ethylidene-N-[[(5E)-8-fluoro-2-methylcycloocta-1,5,7-trien-1-yl]methyl]-3-[(methylideneamino)methylidene]hepta-1,5-dien-2-amine |
|---|---|
| PubChem CID | 174005822 |
| Molecular Formula | C21H27FN2 |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (3Z,4E,5Z)-4-ethylidene-N-[[(5E)-8-fluoro-2-methylcycloocta-1,5,7-trien-1-yl]methyl]-3-[(methylideneamino)methylidene]hepta-1,5-dien-2-amine |
| SMILES | C=N/C=C(C(=C)NCC1=C(C)CC/C=C\C=C1F)\C(/C=C\C)=C\C |
| InChI | InChI=1S/C21H27FN2/c1-6-11-18(7-2)20(14-23-5)17(4)24-15-19-16(3)12-9-8-10-13-21(19)22/h6-8,10-11,13-14,24H,4-5,9,12,15H2,1-3H3/b10-8-,11-6-,18-7+,19-16?,20-14+,21-13? |
| InChIKey | ABARIAYCZQHMGK-PFVRGYRHSA-N |
| XLogP | 5.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|