C30H31BFN5 — CID 174006328
CID 174006328 (PubChem CID 174006328) has the molecular formula C30H31BFN5 and a molecular weight of 491.42 g/mol.
| Compound Name | CID 174006328 |
|---|---|
| PubChem CID | 174006328 |
| Molecular Formula | C30H31BFN5 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2ccc3c(N4CC5CC(C4)N5)nc(CCC4CCCN4C)nc3c2F)c2ccccc2c1 |
| InChI | InChI=1S/C30H31BFN5/c1-36-12-4-6-22(36)8-11-27-34-29-25(30(35-27)37-16-20-15-21(17-37)33-20)10-9-24(28(29)32)26-14-19(31)13-18-5-2-3-7-23(18)26/h2-3,5,7,9-10,13-14,20-22,33H,4,6,8,11-12,15-17H2,1H3 |
| InChIKey | WNONYCOMHLCFGM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|