About (2-tert-butyl-3,4-dichlorophenyl)boronic acid
(2-tert-butyl-3,4-dichlorophenyl)boronic acid (PubChem CID 174006765) has the molecular formula C10H13BCl2O2
and a molecular weight of 246.93 g/mol. Its IUPAC name is (2-tert-butyl-3,4-dichlorophenyl)boronic acid.
Molecular Properties
| Compound Name | (2-tert-butyl-3,4-dichlorophenyl)boronic acid |
| PubChem CID | 174006765 |
| Molecular Formula | C10H13BCl2O2 |
| Molecular Weight | 246.93 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | (2-tert-butyl-3,4-dichlorophenyl)boronic acid |
| SMILES | CC(C)(C)c1c(B(O)O)ccc(Cl)c1Cl |
| InChI | InChI=1S/C10H13BCl2O2/c1-10(2,3)8-6(11(14)15)4-5-7(12)9(8)13/h4-5,14-15H,1-3H3 |
| InChIKey | TZEMAGVTZLLSBF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.93 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butyl-3,4-dichlorophenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-3,4-dichlorophenyl)boronic acid?
The IUPAC name of (2-tert-butyl-3,4-dichlorophenyl)boronic acid (CID 174006765) is (2-tert-butyl-3,4-dichlorophenyl)boronic acid.
What is the SMILES notation for (2-tert-butyl-3,4-dichlorophenyl)boronic acid?
The canonical SMILES for (2-tert-butyl-3,4-dichlorophenyl)boronic acid is CC(C)(C)c1c(B(O)O)ccc(Cl)c1Cl.
What is the InChIKey of (2-tert-butyl-3,4-dichlorophenyl)boronic acid?
The InChIKey is TZEMAGVTZLLSBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BCl2O2/c1-10(2,3)8-6(11(14)15)4-5-7(12)9(8)13/h4-5,14-15H,1-3H3.
What are the key properties of (2-tert-butyl-3,4-dichlorophenyl)boronic acid?
(2-tert-butyl-3,4-dichlorophenyl)boronic acid has a molecular weight of 246.93 g/mol, XLogP of 1.97, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-3,4-dichlorophenyl)boronic acid is sourced from PubChem (CID 174006765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).