About (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine
(2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine (PubChem CID 174007558) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine |
| PubChem CID | 174007558 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine |
| SMILES | CCNC1C(C)CCC(C)[C@H]1C |
| InChI | InChI=1S/C11H23N/c1-5-12-11-9(3)7-6-8(2)10(11)4/h8-12H,5-7H2,1-4H3/t8?,9?,10-,11?/m1/s1 |
| InChIKey | JOWBUJISPRBKFJ-VEKQPKGLSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine?
The IUPAC name of (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine (CID 174007558) is (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine.
What is the SMILES notation for (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine?
The canonical SMILES for (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine is CCNC1C(C)CCC(C)[C@H]1C.
What is the InChIKey of (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine?
The InChIKey is JOWBUJISPRBKFJ-VEKQPKGLSA-N. The full InChI is InChI=1S/C11H23N/c1-5-12-11-9(3)7-6-8(2)10(11)4/h8-12H,5-7H2,1-4H3/t8?,9?,10-,11?/m1/s1.
What are the key properties of (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine?
(2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine has a molecular weight of 169.31 g/mol, XLogP of 2.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-ethyl-2,3,6-trimethylcyclohexan-1-amine is sourced from PubChem (CID 174007558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).