C30H53F2N7O — CID 174007655
22-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-16,19-difluoro-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one (PubChem CID 174007655) has the molecular formula C30H53F2N7O and a molecular weight of 565.80 g/mol. Its IUPAC name is 22-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-16,19-difluoro-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one.
| Compound Name | 22-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-16,19-difluoro-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
|---|---|
| PubChem CID | 174007655 |
| Molecular Formula | C30H53F2N7O |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.43 |
| IUPAC Name | 22-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-16,19-difluoro-3-propan-2-yl-1,4,11,23,26-pentazapentacyclo[16.6.2.02,7.012,17.021,25]hexacosan-24-one |
| SMILES | CC(C)C1NCCC2CCCNC3CCCC(F)C3C3NC4C(CC3F)C(N3C[C@@H](C)NC[C@@H]3C)NC(=O)N4C21 |
| InChI | InChI=1S/C30H53F2N7O/c1-16(2)25-27-19(10-12-34-25)7-6-11-33-23-9-5-8-21(31)24(23)26-22(32)13-20-28(37-30(40)39(27)29(20)36-26)38-15-17(3)35-14-18(38)4/h16-29,33-36H,5-15H2,1-4H3,(H,37,40)/t17-,18+,19?,20?,21?,22?,23?,24?,25?,26?,27?,28?,29?/m1/s1 |
| InChIKey | PNGRUBXIUCCSAA-UGMVVOHPSA-N |
| XLogP | 2.56 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |