C31H48F2N8O3S — CID 174007670
17,20-difluoro-3-propan-2-yl-23-[(1R)-5-prop-2-enoyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-8-thia-1,4,6,12,24,27-hexazapentacyclo[17.6.2.02,7.013,18.022,26]heptacosane-11,25-dione (PubChem CID 174007670) has the molecular formula C31H48F2N8O3S and a molecular weight of 650.84 g/mol. Its IUPAC name is 17,20-difluoro-3-propan-2-yl-23-[(1R)-5-prop-2-enoyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-8-thia-1,4,6,12,24,27-hexazapentacyclo[17.6.2.02,7.013,18.022,26]heptacosane-11,25-dione.
| Compound Name | 17,20-difluoro-3-propan-2-yl-23-[(1R)-5-prop-2-enoyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-8-thia-1,4,6,12,24,27-hexazapentacyclo[17.6.2.02,7.013,18.022,26]heptacosane-11,25-dione |
|---|---|
| PubChem CID | 174007670 |
| Molecular Formula | C31H48F2N8O3S |
| Molecular Weight | 650.84 g/mol |
| Exact Mass | 650.35 |
| IUPAC Name | 17,20-difluoro-3-propan-2-yl-23-[(1R)-5-prop-2-enoyl-2,5-diazabicyclo[4.1.0]heptan-2-yl]-8-thia-1,4,6,12,24,27-hexazapentacyclo[17.6.2.02,7.013,18.022,26]heptacosane-11,25-dione |
| SMILES | C=CC(=O)N1CCN(C2NC(=O)N3C4NC(C(F)CC42)C2C(F)CCCC2NC(=O)CCSC2NCNC(C(C)C)C23)[C@@H]2CC21 |
| InChI | InChI=1S/C31H48F2N8O3S/c1-4-23(43)39-9-10-40(21-13-20(21)39)28-16-12-18(33)26-24-17(32)6-5-7-19(24)36-22(42)8-11-45-30-27(25(15(2)3)34-14-35-30)41(29(16)37-26)31(44)38-28/h4,15-21,24-30,34-35,37H,1,5-14H2,2-3H3,(H,36,42)(H,38,44)/t16?,17?,18?,19?,20?,21-,24?,25?,26?,27?,28?,29?,30?/m1/s1 |
| InChIKey | GSLRPVYBJGZUNQ-SYQAWSLLSA-N |
| XLogP | 1.08 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.84 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|