C20H41N5O7 — CID 174007725
(5R)-2-[(4S,6R)-4,6-diamino-3-[(2R,6S)-3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol (PubChem CID 174007725) has the molecular formula C20H41N5O7 and a molecular weight of 463.58 g/mol. Its IUPAC name is (5R)-2-[(4S,6R)-4,6-diamino-3-[(2R,6S)-3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol.
| Compound Name | (5R)-2-[(4S,6R)-4,6-diamino-3-[(2R,6S)-3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |
|---|---|
| PubChem CID | 174007725 |
| Molecular Formula | C20H41N5O7 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.30 |
| IUPAC Name | (5R)-2-[(4S,6R)-4,6-diamino-3-[(2R,6S)-3-amino-6-(1-aminoethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |
| SMILES | CNC1C(O)C(OC2C(O)C(O[C@H]3O[C@H](C(C)N)CCC3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O |
| InChI | InChI=1S/C20H41N5O7/c1-8(21)12-5-4-9(22)18(30-12)31-15-10(23)6-11(24)16(13(15)26)32-19-14(27)17(25-3)20(2,28)7-29-19/h8-19,25-28H,4-7,21-24H2,1-3H3/t8?,9?,10-,11+,12-,13?,14?,15?,16?,17?,18+,19?,20-/m0/s1 |
| InChIKey | XUFIWSHGXVLULG-FECCWYAKSA-N |
| XLogP | -3.59 |
| TPSA | 213.72 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |