C48H47BN2 — CID 174008197
4,17-ditert-butyl-13-(4-tert-butylphenyl)-10-carbazol-9-yl-13-aza-1-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene (PubChem CID 174008197) has the molecular formula C48H47BN2 and a molecular weight of 662.73 g/mol. Its IUPAC name is 4,17-ditert-butyl-13-(4-tert-butylphenyl)-10-carbazol-9-yl-13-aza-1-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene.
| Compound Name | 4,17-ditert-butyl-13-(4-tert-butylphenyl)-10-carbazol-9-yl-13-aza-1-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene |
|---|---|
| PubChem CID | 174008197 |
| Molecular Formula | C48H47BN2 |
| Molecular Weight | 662.73 g/mol |
| Exact Mass | 662.38 |
| IUPAC Name | 4,17-ditert-butyl-13-(4-tert-butylphenyl)-10-carbazol-9-yl-13-aza-1-borapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14(19),15,17-nonaene |
| SMILES | CC(C)(C)c1ccc(N2c3ccc(C(C)(C)C)cc3B3c4cc(C(C)(C)C)ccc4-c4cc(-n5c6ccccc6c6ccccc65)cc2c43)cc1 |
| InChI | InChI=1S/C48H47BN2/c1-46(2,3)30-18-22-33(23-19-30)50-43-25-21-32(48(7,8)9)27-40(43)49-39-26-31(47(4,5)6)20-24-35(39)38-28-34(29-44(50)45(38)49)51-41-16-12-10-14-36(41)37-15-11-13-17-42(37)51/h10-29H,1-9H3 |
| InChIKey | IOLAVNYPIHNEAT-UHFFFAOYSA-N |
| XLogP | 10.96 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.73 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|