C17H23N3O2S2 — CID 17400888
N-butyl-2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]acetamide (PubChem CID 17400888) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-butyl-2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]acetamide.
| Compound Name | N-butyl-2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 17400888 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-butyl-2-[(4-oxo-6,7,8,9-tetrahydropyrimido[2,1-b][1,3]benzothiazol-2-yl)methylsulfanyl]acetamide |
| SMILES | CCCCNC(=O)CSCc1cc(=O)n2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C17H23N3O2S2/c1-2-3-8-18-15(21)11-23-10-12-9-16(22)20-13-6-4-5-7-14(13)24-17(20)19-12/h9H,2-8,10-11H2,1H3,(H,18,21) |
| InChIKey | ICZUOQSGTUOLQL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|