About 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide
2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide (PubChem CID 17400914) has the molecular formula C21H25NO3S
and a molecular weight of 371.50 g/mol. Its IUPAC name is 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide.
Molecular Properties
| Compound Name | 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide |
| PubChem CID | 17400914 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide |
| SMILES | CCCN(C(=O)c1ccccc1Cc1ccccc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C21H25NO3S/c1-2-13-22(19-12-14-26(24,25)16-19)21(23)20-11-7-6-10-18(20)15-17-8-4-3-5-9-17/h3-11,19H,2,12-16H2,1H3 |
| InChIKey | GUICZPAMJSQYRY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide?
The IUPAC name of 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide (CID 17400914) is 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide.
What is the SMILES notation for 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide?
The canonical SMILES for 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide is CCCN(C(=O)c1ccccc1Cc1ccccc1)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide?
The InChIKey is GUICZPAMJSQYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3S/c1-2-13-22(19-12-14-26(24,25)16-19)21(23)20-11-7-6-10-18(20)15-17-8-4-3-5-9-17/h3-11,19H,2,12-16H2,1H3.
What are the key properties of 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide?
2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide has a molecular weight of 371.50 g/mol, XLogP of 3.32, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-N-(1,1-dioxothiolan-3-yl)-N-propylbenzamide is sourced from PubChem (CID 17400914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).