C21H26N10O11P2 — CID 174009304
2-amino-9-[(6R,8R,15R,17R)-8-(6-aminopurin-9-yl)-3,12,18-trihydroxy-3,12-dioxo-2,4,7,11,13-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 174009304) has the molecular formula C21H26N10O11P2 and a molecular weight of 656.45 g/mol. Its IUPAC name is 2-amino-9-[(6R,8R,15R,17R)-8-(6-aminopurin-9-yl)-3,12,18-trihydroxy-3,12-dioxo-2,4,7,11,13-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(6R,8R,15R,17R)-8-(6-aminopurin-9-yl)-3,12,18-trihydroxy-3,12-dioxo-2,4,7,11,13-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 174009304 |
| Molecular Formula | C21H26N10O11P2 |
| Molecular Weight | 656.45 g/mol |
| Exact Mass | 656.13 |
| IUPAC Name | 2-amino-9-[(6R,8R,15R,17R)-8-(6-aminopurin-9-yl)-3,12,18-trihydroxy-3,12-dioxo-2,4,7,11,13-pentaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@@H]2C[C@@H]3COP(=O)(O)OC4C[C@H](n5cnc6c(N)ncnc65)O[C@@H]4COP(=O)(O)OC3C2O)c(=O)[nH]1 |
| InChI | InChI=1S/C21H26N10O11P2/c22-17-13-18(25-5-24-17)31(7-26-13)12-2-10-11(40-12)4-39-44(36,37)42-16-8(3-38-43(34,35)41-10)1-9(15(16)32)30-6-27-14-19(30)28-21(23)29-20(14)33/h5-12,15-16,32H,1-4H2,(H,34,35)(H,36,37)(H2,22,24,25)(H3,23,28,29,33)/t8-,9-,10?,11-,12-,15?,16?/m1/s1 |
| InChIKey | CMCJSVUTCJCNJL-YMFURZQPSA-N |
| XLogP | -0.65 |
| TPSA | 300.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.45 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|