C18H16N6 — CID 174009344
4-[[4-(3,4-diiminocyclohexa-1,5-dien-1-yl)iminocyclohexa-2,5-dien-1-ylidene]amino]benzene-1,2-diamine (PubChem CID 174009344) has the molecular formula C18H16N6 and a molecular weight of 316.37 g/mol. Its IUPAC name is 4-[[4-(3,4-diiminocyclohexa-1,5-dien-1-yl)iminocyclohexa-2,5-dien-1-ylidene]amino]benzene-1,2-diamine.
| Compound Name | 4-[[4-(3,4-diiminocyclohexa-1,5-dien-1-yl)iminocyclohexa-2,5-dien-1-ylidene]amino]benzene-1,2-diamine |
|---|---|
| PubChem CID | 174009344 |
| Molecular Formula | C18H16N6 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-[[4-(3,4-diiminocyclohexa-1,5-dien-1-yl)iminocyclohexa-2,5-dien-1-ylidene]amino]benzene-1,2-diamine |
| SMILES | [H]/N=C1\C=CC(N=C2C=CC(=Nc3ccc(N)c(N)c3)C=C2)=C\C1=N/[H] |
| InChI | InChI=1S/C18H16N6/c19-15-7-5-13(9-17(15)21)23-11-1-2-12(4-3-11)24-14-6-8-16(20)18(22)10-14/h1-10,19,21H,20,22H2/b19-15+,21-17+,23-11-,24-12+ |
| InChIKey | FUYILVLYTLOIMN-NVVKFYHRSA-N |
| XLogP | 2.98 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|