C33H52F6N2 — CID 174009444
(5S,6S,10E,12Z,15R)-5,6,15-trimethyl-9-N-[(E,2S)-6,6,6-trifluoro-4-methylhex-3-en-2-yl]-2-N-(5,5,5-trifluoropentylidene)octadeca-1,10,12-triene-2,9-diimine (PubChem CID 174009444) has the molecular formula C33H52F6N2 and a molecular weight of 590.78 g/mol. Its IUPAC name is (5S,6S,10E,12Z,15R)-5,6,15-trimethyl-9-N-[(E,2S)-6,6,6-trifluoro-4-methylhex-3-en-2-yl]-2-N-(5,5,5-trifluoropentylidene)octadeca-1,10,12-triene-2,9-diimine.
| Compound Name | (5S,6S,10E,12Z,15R)-5,6,15-trimethyl-9-N-[(E,2S)-6,6,6-trifluoro-4-methylhex-3-en-2-yl]-2-N-(5,5,5-trifluoropentylidene)octadeca-1,10,12-triene-2,9-diimine |
|---|---|
| PubChem CID | 174009444 |
| Molecular Formula | C33H52F6N2 |
| Molecular Weight | 590.78 g/mol |
| Exact Mass | 590.40 |
| IUPAC Name | (5S,6S,10E,12Z,15R)-5,6,15-trimethyl-9-N-[(E,2S)-6,6,6-trifluoro-4-methylhex-3-en-2-yl]-2-N-(5,5,5-trifluoropentylidene)octadeca-1,10,12-triene-2,9-diimine |
| SMILES | C=C(CC[C@H](C)[C@@H](C)CCC(/C=C/C=C\C[C@H](C)CCC)=N\[C@@H](C)/C=C(\C)CC(F)(F)F)/N=C/CCCC(F)(F)F |
| InChI | InChI=1S/C33H52F6N2/c1-8-14-25(2)15-10-9-11-16-31(41-30(7)23-26(3)24-33(37,38)39)20-18-28(5)27(4)17-19-29(6)40-22-13-12-21-32(34,35)36/h9-11,16,22-23,25,27-28,30H,6,8,12-15,17-21,24H2,1-5,7H3/b10-9-,16-11+,26-23+,40-22+,41-31-/t25-,27+,28+,30+/m1/s1 |
| InChIKey | PHCNGCUZYDJBPW-CPNXWFNQSA-N |
| XLogP | 11.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.78 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|