C21H36F3NO2 — CID 174009665
1-methoxy-3-[6-[(3S,4Z,6S)-6-methyl-6-(trifluoromethyl)octa-1,4-dien-3-yl]azocan-3-yl]propan-2-ol (PubChem CID 174009665) has the molecular formula C21H36F3NO2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-methoxy-3-[6-[(3S,4Z,6S)-6-methyl-6-(trifluoromethyl)octa-1,4-dien-3-yl]azocan-3-yl]propan-2-ol.
| Compound Name | 1-methoxy-3-[6-[(3S,4Z,6S)-6-methyl-6-(trifluoromethyl)octa-1,4-dien-3-yl]azocan-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 174009665 |
| Molecular Formula | C21H36F3NO2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 1-methoxy-3-[6-[(3S,4Z,6S)-6-methyl-6-(trifluoromethyl)octa-1,4-dien-3-yl]azocan-3-yl]propan-2-ol |
| SMILES | C=C[C@H](/C=C\[C@](C)(CC)C(F)(F)F)C1CCNCC(CC(O)COC)CC1 |
| InChI | InChI=1S/C21H36F3NO2/c1-5-17(9-11-20(3,6-2)21(22,23)24)18-8-7-16(14-25-12-10-18)13-19(26)15-27-4/h5,9,11,16-19,25-26H,1,6-8,10,12-15H2,2-4H3/b11-9-/t16?,17-,18?,19?,20+/m1/s1 |
| InChIKey | XXIOGLYMMADPMF-DOOHZZATSA-N |
| XLogP | 4.73 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|