C20H34O6Si2 — CID 174009869
[(4aR,6S,8aR)-6-methoxy-2-phenyl-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-trimethylsilane (PubChem CID 174009869) has the molecular formula C20H34O6Si2 and a molecular weight of 426.66 g/mol. Its IUPAC name is [(4aR,6S,8aR)-6-methoxy-2-phenyl-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-trimethylsilane.
| Compound Name | [(4aR,6S,8aR)-6-methoxy-2-phenyl-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 174009869 |
| Molecular Formula | C20H34O6Si2 |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(4aR,6S,8aR)-6-methoxy-2-phenyl-7-trimethylsilyloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-trimethylsilane |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C20H34O6Si2/c1-21-20-18(26-28(5,6)7)17(25-27(2,3)4)16-15(23-20)13-22-19(24-16)14-11-9-8-10-12-14/h8-12,15-20H,13H2,1-7H3/t15-,16-,17?,18?,19?,20+/m1/s1 |
| InChIKey | FDCVGVOCLNEJST-AEENIXFBSA-N |
| XLogP | 3.91 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|