C26H25NS — CID 174009964
(4E,5Z,7Z)-4-(3-methylbutan-2-ylidene)-13-phenyl-14-thia-12-azatricyclo[8.7.0.011,15]heptadeca-1(10),2,5,7,11(15),12,16-heptaene (PubChem CID 174009964) has the molecular formula C26H25NS and a molecular weight of 383.56 g/mol. Its IUPAC name is (4E,5Z,7Z)-4-(3-methylbutan-2-ylidene)-13-phenyl-14-thia-12-azatricyclo[8.7.0.011,15]heptadeca-1(10),2,5,7,11(15),12,16-heptaene.
| Compound Name | (4E,5Z,7Z)-4-(3-methylbutan-2-ylidene)-13-phenyl-14-thia-12-azatricyclo[8.7.0.011,15]heptadeca-1(10),2,5,7,11(15),12,16-heptaene |
|---|---|
| PubChem CID | 174009964 |
| Molecular Formula | C26H25NS |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (4E,5Z,7Z)-4-(3-methylbutan-2-ylidene)-13-phenyl-14-thia-12-azatricyclo[8.7.0.011,15]heptadeca-1(10),2,5,7,11(15),12,16-heptaene |
| SMILES | C/C(=C1C=Cc2ccc3sc(-c4ccccc4)nc3c2C/C=C/C=C\1)C(C)C |
| InChI | InChI=1S/C26H25NS/c1-18(2)19(3)20-10-6-5-9-13-23-21(15-14-20)16-17-24-25(23)27-26(28-24)22-11-7-4-8-12-22/h4-12,14-18H,13H2,1-3H3/b9-5-,10-6-,15-14?,20-19+ |
| InChIKey | KJBSHQLTCTUNIS-INSJZATDSA-N |
| XLogP | 7.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |