C16H20 — CID 174010149
6,7-bis[(Z)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 174010149) has the molecular formula C16H20 and a molecular weight of 212.34 g/mol. Its IUPAC name is 6,7-bis[(Z)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6,7-bis[(Z)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 174010149 |
| Molecular Formula | C16H20 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 6,7-bis[(Z)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C\c1cc2c(cc1/C=C\C)CCCC2 |
| InChI | InChI=1S/C16H20/c1-3-7-13-11-15-9-5-6-10-16(15)12-14(13)8-4-2/h3-4,7-8,11-12H,5-6,9-10H2,1-2H3/b7-3-,8-4- |
| InChIKey | YAQUTMYMKNRJDG-VHOZIDCHSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |