C21H38O3Si — CID 174010533
(2R,3R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-2-(3-oxobutyl)-5-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 174010533) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (2R,3R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-2-(3-oxobutyl)-5-prop-1-en-2-ylcyclohexan-1-one.
| Compound Name | (2R,3R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-2-(3-oxobutyl)-5-prop-1-en-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 174010533 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (2R,3R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethyl-2-(3-oxobutyl)-5-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@](C)(CCC(C)=O)[C@@H](C)C1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O3Si/c1-14(2)17-13-18(23)21(8,12-11-15(3)22)16(4)19(17)24-25(9,10)20(5,6)7/h16-17,19H,1,11-13H2,2-10H3/t16-,17+,19?,21+/m0/s1 |
| InChIKey | FYNMLKWANBKLQB-FBDBQFAFSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|