About (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine
(6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine (PubChem CID 174011043) has the molecular formula C16H31N
and a molecular weight of 237.43 g/mol. Its IUPAC name is (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine.
Molecular Properties
| Compound Name | (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine |
| PubChem CID | 174011043 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine |
| SMILES | CC[C@H](C)CC(C)(C/C(C)=N\C)C(C)=C(C)C |
| InChI | InChI=1S/C16H31N/c1-9-13(4)10-16(7,11-14(5)17-8)15(6)12(2)3/h13H,9-11H2,1-8H3/b17-14-/t13-,16?/m0/s1 |
| InChIKey | ZQBQVFYJDNBGFT-YOEVBHMESA-N |
| XLogP | 5.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine?
The IUPAC name of (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine (CID 174011043) is (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine.
What is the SMILES notation for (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine?
The canonical SMILES for (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine is CC[C@H](C)CC(C)(C/C(C)=N\C)C(C)=C(C)C.
What is the InChIKey of (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine?
The InChIKey is ZQBQVFYJDNBGFT-YOEVBHMESA-N. The full InChI is InChI=1S/C16H31N/c1-9-13(4)10-16(7,11-14(5)17-8)15(6)12(2)3/h13H,9-11H2,1-8H3/b17-14-/t13-,16?/m0/s1.
What are the key properties of (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine?
(6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine has a molecular weight of 237.43 g/mol, XLogP of 5.27, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-N,4,6-trimethyl-4-(3-methylbut-2-en-2-yl)octan-2-imine is sourced from PubChem (CID 174011043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).