C17H16N4OS — CID 174011259
N-[[4-(1-amino-3-methyliminoprop-1-en-2-yl)phenyl]methyl]-2-ethynyl-1,3-thiazole-4-carboxamide (PubChem CID 174011259) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[[4-(1-amino-3-methyliminoprop-1-en-2-yl)phenyl]methyl]-2-ethynyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[[4-(1-amino-3-methyliminoprop-1-en-2-yl)phenyl]methyl]-2-ethynyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 174011259 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[[4-(1-amino-3-methyliminoprop-1-en-2-yl)phenyl]methyl]-2-ethynyl-1,3-thiazole-4-carboxamide |
| SMILES | C#Cc1nc(C(=O)NCc2ccc(C(=CN)/C=N/C)cc2)cs1 |
| InChI | InChI=1S/C17H16N4OS/c1-3-16-21-15(11-23-16)17(22)20-9-12-4-6-13(7-5-12)14(8-18)10-19-2/h1,4-8,10-11H,9,18H2,2H3,(H,20,22)/b14-8?,19-10+ |
| InChIKey | NTKQFQKAKODTKV-XQQIOWMPSA-N |
| XLogP | 2.05 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|