C21H26FN10O11P — CID 174011496
[(2R,3R,4S,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-fluoro-4-hydroxy-5-(2-hydroxyethyl)oxolan-3-yl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 174011496) has the molecular formula C21H26FN10O11P and a molecular weight of 644.47 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-fluoro-4-hydroxy-5-(2-hydroxyethyl)oxolan-3-yl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3R,4S,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-fluoro-4-hydroxy-5-(2-hydroxyethyl)oxolan-3-yl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 174011496 |
| Molecular Formula | C21H26FN10O11P |
| Molecular Weight | 644.47 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | [(2R,3R,4S,5S)-2-(2-amino-6-oxo-1H-purin-9-yl)-5-fluoro-4-hydroxy-5-(2-hydroxyethyl)oxolan-3-yl] [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@@H]2O[C@](F)(CCO)[C@@H](O)[C@H]2OP(=O)(O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](O)[C@@H]2O)c(=O)[nH]1 |
| InChI | InChI=1S/C21H26FN10O11P/c22-21(1-2-33)13(36)12(19(42-21)32-6-28-9-16(32)29-20(24)30-17(9)37)43-44(38,39)40-3-7-10(34)11(35)18(41-7)31-5-27-8-14(23)25-4-26-15(8)31/h4-7,10-13,18-19,33-36H,1-3H2,(H,38,39)(H2,23,25,26)(H3,24,29,30,37)/t7-,10-,11-,12-,13+,18-,19-,21-/m1/s1 |
| InChIKey | UZVSIYNKQUNHTL-XLFILICESA-N |
| XLogP | -2.82 |
| TPSA | 314.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.47 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|