C14H24OS — CID 174011556
(2E,3Z,5E)-2-butan-2-ylidene-5-(2-sulfanylpropan-2-yl)hepta-3,5-dien-1-ol (PubChem CID 174011556) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is (2E,3Z,5E)-2-butan-2-ylidene-5-(2-sulfanylpropan-2-yl)hepta-3,5-dien-1-ol.
| Compound Name | (2E,3Z,5E)-2-butan-2-ylidene-5-(2-sulfanylpropan-2-yl)hepta-3,5-dien-1-ol |
|---|---|
| PubChem CID | 174011556 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (2E,3Z,5E)-2-butan-2-ylidene-5-(2-sulfanylpropan-2-yl)hepta-3,5-dien-1-ol |
| SMILES | C/C=C(\C=C/C(CO)=C(/C)CC)C(C)(C)S |
| InChI | InChI=1S/C14H24OS/c1-6-11(3)12(10-15)8-9-13(7-2)14(4,5)16/h7-9,15-16H,6,10H2,1-5H3/b9-8-,12-11+,13-7+ |
| InChIKey | QRZNMAIFNJPDGD-BFRDDWBESA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|