C17H28F2O — CID 174011601
(2E,4Z,6Z)-6-butan-2-ylidene-3-(2,2-difluoroethoxy)-8-methyldeca-2,4-diene (PubChem CID 174011601) has the molecular formula C17H28F2O and a molecular weight of 286.41 g/mol. Its IUPAC name is (2E,4Z,6Z)-6-butan-2-ylidene-3-(2,2-difluoroethoxy)-8-methyldeca-2,4-diene.
| Compound Name | (2E,4Z,6Z)-6-butan-2-ylidene-3-(2,2-difluoroethoxy)-8-methyldeca-2,4-diene |
|---|---|
| PubChem CID | 174011601 |
| Molecular Formula | C17H28F2O |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (2E,4Z,6Z)-6-butan-2-ylidene-3-(2,2-difluoroethoxy)-8-methyldeca-2,4-diene |
| SMILES | C/C=C(\C=C/C(CC(C)CC)=C(/C)CC)OCC(F)F |
| InChI | InChI=1S/C17H28F2O/c1-6-13(4)11-15(14(5)7-2)9-10-16(8-3)20-12-17(18)19/h8-10,13,17H,6-7,11-12H2,1-5H3/b10-9-,15-14+,16-8+ |
| InChIKey | LJXSTRUNCKVYNP-VKHMRIDVSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|