C44H23B5O — CID 174011853
CID 174011853 (PubChem CID 174011853) has the molecular formula C44H23B5O and a molecular weight of 621.73 g/mol.
| Compound Name | CID 174011853 |
|---|---|
| PubChem CID | 174011853 |
| Molecular Formula | C44H23B5O |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2c3ccccc3c(-c3ccc4oc5c(-c6cccc(-c7ccccc7)c6)cccc5c4c3)c3ccccc23)c([B])c1[B] |
| InChI | InChI=1S/C44H23B5O/c45-39-38(40(46)42(48)43(49)41(39)47)37-31-16-6-4-14-29(31)36(30-15-5-7-17-32(30)37)27-20-21-35-34(23-27)33-19-9-18-28(44(33)50-35)26-13-8-12-25(22-26)24-10-2-1-3-11-24/h1-23H |
| InChIKey | NKXWKLZWZSKERD-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|