C21H24BF3N2O5 — CID 174012438
N-[(9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 174012438) has the molecular formula C21H24BF3N2O5 and a molecular weight of 452.24 g/mol. Its IUPAC name is N-[(9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-[(9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 174012438 |
| Molecular Formula | C21H24BF3N2O5 |
| Molecular Weight | 452.24 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | N-[(9,9-dimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CC1(C)C2CC3OB(CNC(=O)C4CC(c5ccccc5OC(F)(F)F)=NO4)OC3C1C2 |
| InChI | InChI=1S/C21H24BF3N2O5/c1-20(2)11-7-13(20)18-16(8-11)30-22(31-18)10-26-19(28)17-9-14(27-32-17)12-5-3-4-6-15(12)29-21(23,24)25/h3-6,11,13,16-18H,7-10H2,1-2H3,(H,26,28) |
| InChIKey | GXPMSTTUZMEIBZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|